| Name | Disperse Red 60 |
| Synonyms | Disperse Red 60 Disperse Red E-4B C.I.Disperse Red 71 1-Amino-4-hydroxy-2-phenoxy-9,10-anthraquinone 1-amino-4-hydroxy-2-phenoxyanthra-9,10-quinone 1-amino-4-hydroxy-2-phenoxyanthracene-9,10-dione 9,10-anthracenedione, 1-amino-4-hydroxy-2-phenoxy- 1-amino-4-hydroxy-2-phenoxy-9,10-dihydroanthracene-9,10-dione |
| CAS | 12223-37-9 |
| EINECS | 241-442-6 |
| InChI | InChI=1/C20H13NO4/c21-18-15(25-11-6-2-1-3-7-11)10-14(22)16-17(18)20(24)13-9-5-4-8-12(13)19(16)23/h1-10,22H,21H2 |
| Molecular Formula | C20H13NO4 |
| Molar Mass | 331.326 |
| Density | 1.438g/cm3 |
| Boling Point | 570.3°C at 760 mmHg |
| Flash Point | 298.7°C |
| Vapor Presure | 1.31E-13mmHg at 25°C |
| Refractive Index | 1.722 |
| Use | for dyeing and printing of polyester and its blends |